![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Hull Breach (1).jpg | 2019-03-24 13:42 | 109K | |
![[IMG]](/icons/image2.gif) | Wrexial, the Risen Deep (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Sigil Captain (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Lightning Greaves (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Gruul Signet (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Stitch Together (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Oni of Wild Places (1).jpg | 2019-03-24 13:42 | 112K | |
![[IMG]](/icons/image2.gif) | Forest (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Flusterstorm (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Dragon Whelp (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Vivid Meadow (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Veteran Explorer (1).jpg | 2019-03-24 13:42 | 99K | |
![[IMG]](/icons/image2.gif) | Molten Slagheap (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Golgari Signet (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Golgari Guildmage (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Firespout (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Austere Command (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Vedalken Plotter (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Shared Trauma (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Ghostly Prison (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Dimir Aqueduct (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Angel of Despair (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Vivid Grove (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Dreamborn Muse (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Collective Voyage (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Aquastrand Spider (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Alliance of Arms (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Orzhov Basilica (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Fire+Ice (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Dominus of Fealty (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Cultivate (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Wall of Omens (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Scattering Stroke (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Plains (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Penumbra Spider (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Archangel of Strife (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Propaganda (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Prison Term (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Island (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Gwyllion Hedge-Mage (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Desecrator Hag (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Skullclamp (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Nantuko Husk (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Lhurgoyf (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Crescendo of War (1).jpg | 2019-03-24 13:42 | 80K | |
![[IMG]](/icons/image2.gif) | Whirlpool Whelm (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Vivid Creek (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Squallmonger (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Patron of the Nezumi (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Cobra Trap (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Storm Herd (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Kazandu Refuge (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Hornet Queen (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Brainstorm (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Artisan of Kozilek (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Scythe Specter (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Evolving Wilds (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Breath of Darigaaz (1).jpg | 2019-03-24 13:42 | 105K | |
![[IMG]](/icons/image2.gif) | Avatar of Fury (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Valley Rannet (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Szadek, Lord of Secrets (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Nezumi Graverobber (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Explosive Vegetation (1).jpg | 2019-03-24 13:42 | 108K | |
![[IMG]](/icons/image2.gif) | Damia, Sage of Stone (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Vorosh, the Hunter (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Troll Ascetic (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Teneb, the Harvester (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Mother of Runes (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Command Tower (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Spitebellows (1).jpg | 2019-03-24 13:42 | 111K | |
![[IMG]](/icons/image2.gif) | Reins of Power (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Krosan Tusker (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Grave Pact (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Terramorphic Expanse (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Kodama's Reach (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Invigorate (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Elvish Aberration (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Avatar of Slaughter (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Vow of Flight (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Selesnya Evangel (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Numot, the Devastator (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Dark Hatchling (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Acidic Slime (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Skyscribing (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Intet, the Dreamer (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Hour of Reckoning (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Chain Reaction (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Attrition (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Selesnya Signet (1).jpg | 2019-03-24 13:42 | 99K | |
![[IMG]](/icons/image2.gif) | Insurrection (1).jpg | 2019-03-24 13:42 | 99K | |
![[IMG]](/icons/image2.gif) | Fellwar Stone (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Diabolic Tutor (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Malfegor (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Lightkeeper of Emeria (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Izzet Signet (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Earthquake (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Angelic Arbiter (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Voice of All (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Simic Sky Swallower (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Perilous Research (1).jpg | 2019-03-24 13:42 | 104K | |
![[IMG]](/icons/image2.gif) | Lonely Sandbar (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Hex (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Rakdos Carnarium (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Journey to Nowhere (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Howling Mine (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Electrolyze (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Disaster Radius (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Tribute to the Wild (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Serra Angel (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Rise from the Grave (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Evincar's Justice (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Bathe in Light (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Vengeful Rebirth (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Memory Erosion (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Harmonize (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Fog Bank (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Congregate (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Vow of Duty (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Slipstream Eel (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Fists of Ironwood (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Champion's Helm (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Selesnya Sanctuary (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Oblivion Ring (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Gomazoa (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Akoum Refuge (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Afterlife (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Vulturous Zombie (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Oros, the Avenger (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Mortify (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Fleshbag Marauder (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Akroma's Vengeance (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Vow of Malice (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Vow of Lightning (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Soul Snare (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Murmurs from Beyond (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Conundrum Sphinx (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Vish Kal, Blood Arbiter (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Jwar Isle Refuge (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Jotun Grunt (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Ghave, Guru of Spores (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Deadly Recluse (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Wrecking Ball (1).jpg | 2019-03-24 13:42 | 103K | |
![[IMG]](/icons/image2.gif) | Vampire Nighthawk (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Hunting Pack (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | False Prophet (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Wall of Denial (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Tariel, Reckoner of Souls (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Spawnwrithe (1).jpg | 2019-03-24 13:42 | 80K | |
![[IMG]](/icons/image2.gif) | Sol Ring (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Selesnya Guildmage (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Repulse (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Martyr's Bond (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Guard Gomazoa (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Gruul Turf (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Basandra, Battle Seraph (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Spell Crumple (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Nin, the Pain Artist (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Faultgrinder (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Extractor Demon (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Sign in Blood (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Secluded Steppe (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Savage Twister (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Colossal Might (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Chaos Warp (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Zedruu the Greathearted (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Trade Secrets (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Izzet Boilerworks (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Boros Signet (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Plumeveil (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Oblation (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Garruk Wildspeaker (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Dimir Signet (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Aethersnipe (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Ruhan of the Fomori (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Mortivore (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Master Warcraft (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Bestial Menace (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Vivid Marsh (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Trench Gorger (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Necrogenesis (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Gravedigger (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Buried Alive (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Shattered Angel (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Hydra Omnivore (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Dreadship Reef (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Call the Skybreaker (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Acorn Catapult (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Vivid Crag (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Orzhov Signet (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Monk Realist (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Bojuka Bog (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Return to Dust (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Mulldrifter (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Homeward Path (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Golgari Rot Farm (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Goblin Cadets (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Symbiotic Wurm (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Skullbriar, the Walking Grave (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Punishing Fire (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Forgotten Cave (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Armillary Sphere (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Wonder (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Wild Ricochet (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Simic Signet (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Orim's Thunder (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Windborn Muse (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Swamp (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Rakdos Signet (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Pyrohemia (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Court Hussar (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Minds Aglow (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Magmatic Force (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Dreamstone Hedron (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Celestial Force (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Awakening Zone (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Vow of Wildness (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Svogthos, the Restless Tomb (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Lash Out (1).jpg | 2019-03-24 13:42 | 107K | |
![[IMG]](/icons/image2.gif) | Footbottom Feast (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Boros Guildmage (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Path to Exile (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Chromeshell Crab (1).jpg | 2019-03-24 13:42 | 114K | |
![[IMG]](/icons/image2.gif) | Butcher of Malakir (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Anger (1).jpg | 2019-03-24 13:42 | 106K | |
![[IMG]](/icons/image2.gif) | Scavenging Ooze (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Sakura-Tribe Elder (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Reiver Demon (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Fallen Angel (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Comet Storm (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Arbiter of Knollridge (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Fertilid (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Fact or Fiction (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Edric, Spymaster of Trest (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Duergar Hedge-Mage (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Zoetic Cavern (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Sulfurous Blast (1).jpg | 2019-03-24 13:42 | 109K | |
![[IMG]](/icons/image2.gif) | Stranglehold (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Spike Feeder (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Avatar of Woe (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Tranquil Thicket (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Razorjaw Oni (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Orzhov Guildmage (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Nemesis Trap (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | The Mimeoplasm (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Ruination (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Relic Crush (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Mountain (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Living Death (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Shriekmaw (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Rupture Spire (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Oblivion Stone (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Mana-Charged Dragon (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Brawn (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Prophetic Prism (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Pollen Lullaby (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Flametongue Kavu (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Aura Shards (1).jpg | 2019-03-24 13:42 | 106K | |
![[IMG]](/icons/image2.gif) | Temple of the False God (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Chorus of the Conclave (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Prophetic Bolt (1).jpg | 2019-03-24 13:42 | 103K | |
![[IMG]](/icons/image2.gif) | Kaalia of the Vast (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Akroma, Angel of Fury (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Riku of Two Reflections (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Righteous Cause (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Izzet Chronarch (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Dread Cacodemon (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Death by Dragons (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Riddlekeeper (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Brion Stoutarm (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Boros Garrison (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Azorius Chancery (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Windfall (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Chartooth Cougar (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Bladewing the Risen (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Ray of Command (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Deadwood Treefolk (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Vision Skeins (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Triskelavus (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Solemn Simulacrum (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Karador, Ghost Chieftain (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Animar, Soul of Elements (1).jpg | 2019-03-24 13:42 | 90K | |
![[ ]](/icons/unknown.gif) | names | 2019-03-24 13:42 | 12K | |
![[IMG]](/icons/image2.gif) | Doom Blade (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Spurnmage Advocate (1).jpg | 2019-03-24 13:42 | 80K | |
![[IMG]](/icons/image2.gif) | Rapacious One (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Death Mutation (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Baloth Woodcrasher (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Syphon Flesh (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Sewer Nemesis (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Furnace Whelp (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Fungal Reaches (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Cleansing Beam (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Yavimaya Elder (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Syphon Mind (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Nucklavee (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Magus of the Vineyard (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Azorius Guildmage (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Terminate (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Simic Growth Chamber (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Fierce Empath (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Darksteel Ingot (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Barren Moor (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Unnerve (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Eternal Witness (1).jpg | 2019-03-24 13:42 | 90K | |
|