![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | names | 2019-03-24 13:42 | 12K | |
![[IMG]](/icons/image2.gif) | 324.jpg | 2019-03-24 13:42 | 40K | |
![[IMG]](/icons/image2.gif) | 330.jpg | 2019-03-24 13:42 | 43K | |
![[IMG]](/icons/image2.gif) | 334.jpg | 2019-03-24 13:42 | 44K | |
![[IMG]](/icons/image2.gif) | 329.jpg | 2019-03-24 13:42 | 44K | |
![[IMG]](/icons/image2.gif) | Command Beacon (1).jpg | 2019-03-24 13:42 | 46K | |
![[IMG]](/icons/image2.gif) | Scoured Barrens (1).jpg | 2019-03-24 13:42 | 47K | |
![[IMG]](/icons/image2.gif) | Tainted Field (1).jpg | 2019-03-24 13:42 | 47K | |
![[IMG]](/icons/image2.gif) | Barter in Blood (1).jpg | 2019-03-24 13:42 | 47K | |
![[IMG]](/icons/image2.gif) | Open the Vaults (1).jpg | 2019-03-24 13:42 | 48K | |
![[IMG]](/icons/image2.gif) | 320.jpg | 2019-03-24 13:42 | 48K | |
![[IMG]](/icons/image2.gif) | Dawnbreak Reclaimer (1).jpg | 2019-03-24 13:42 | 48K | |
![[IMG]](/icons/image2.gif) | Victory's Herald (1).jpg | 2019-03-24 13:42 | 49K | |
![[IMG]](/icons/image2.gif) | 326.jpg | 2019-03-24 13:42 | 49K | |
![[IMG]](/icons/image2.gif) | Silent Sentinel (1).jpg | 2019-03-24 13:42 | 49K | |
![[IMG]](/icons/image2.gif) | Jungle Hollow (1).jpg | 2019-03-24 13:42 | 49K | |
![[IMG]](/icons/image2.gif) | Deadly Tempest (1).jpg | 2019-03-24 13:42 | 50K | |
![[IMG]](/icons/image2.gif) | Shielded by Faith (1).jpg | 2019-03-24 13:42 | 50K | |
![[IMG]](/icons/image2.gif) | Viridian Zealot (1).jpg | 2019-03-24 13:42 | 50K | |
![[IMG]](/icons/image2.gif) | Staff of Nin (1).jpg | 2019-03-24 13:42 | 50K | |
![[IMG]](/icons/image2.gif) | Wretched Confluence (1).jpg | 2019-03-24 13:42 | 50K | |
![[IMG]](/icons/image2.gif) | Dread Summons (1).jpg | 2019-03-24 13:42 | 50K | |
![[IMG]](/icons/image2.gif) | Eater of Hope (1).jpg | 2019-03-24 13:42 | 50K | |
![[IMG]](/icons/image2.gif) | Aura of Silence (1).jpg | 2019-03-24 13:42 | 51K | |
![[IMG]](/icons/image2.gif) | Stolen Goods (1).jpg | 2019-03-24 13:42 | 51K | |
![[IMG]](/icons/image2.gif) | Righteous Confluence (1).jpg | 2019-03-24 13:42 | 51K | |
![[IMG]](/icons/image2.gif) | Wind-Scarred Crag (1).jpg | 2019-03-24 13:42 | 51K | |
![[IMG]](/icons/image2.gif) | Blood Bairn (1).jpg | 2019-03-24 13:42 | 51K | |
![[IMG]](/icons/image2.gif) | Dawnglare Invoker (1).jpg | 2019-03-24 13:42 | 51K | |
![[IMG]](/icons/image2.gif) | Karmic Justice (1).jpg | 2019-03-24 13:42 | 51K | |
![[IMG]](/icons/image2.gif) | Skullwinder (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Ancient Craving (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Thought Vessel (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Orzhov Cluestone (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Nighthowler (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Lone Revenant (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Scytheclaw (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Crystal Chimes (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Banishing Light (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Grasp of Fate (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Thelonite Hermit (1).jpg | 2019-03-24 13:42 | 52K | |
![[IMG]](/icons/image2.gif) | Ambition's Cost (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Lotleth Troll (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Putrefy (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Mystic Confluence (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | 328.jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Jet Medallion (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Caller of the Pack (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Doomwake Giant (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Gild (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Grave Peril (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | 318.jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Scourge of Nel Toth (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Spider Spawning (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Faith's Fetters (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Mystic Retrieval (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Blasted Landscape (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Dominate (1).jpg | 2019-03-24 13:42 | 53K | |
![[IMG]](/icons/image2.gif) | Preordain (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Dawn to Dusk (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Herald of the Host (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Jareth, Leonine Titan (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Psychosis Crawler (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Thief of Blood (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | 322.jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Phyrexian Arena (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Bastion Protector (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Teysa, Envoy of Ghosts (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Day of the Dragons (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | High Market (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Verdant Confluence (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Chameleon Colossus (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Experiment One (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | 331.jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Bident of Thassa (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Mesa Enchantress (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Sigil of the Empty Throne (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Rogue's Passage (1).jpg | 2019-03-24 13:42 | 54K | |
![[IMG]](/icons/image2.gif) | Cold-Eyed Selkie (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Cage of Hands (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | 337.jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Rampant Growth (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Dictate of Heliod (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Centaur Vinecrasher (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Arcane Lighthouse (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Moonsilver Spear (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Gigantoplasm (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Angel of Serenity (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Sandstone Oracle (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Champion of Stray Souls (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Boros Cluestone (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Swiftwater Cliffs (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Oreskos Explorer (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | 319.jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Repeal (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Underworld Connections (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | Orochi Hatchery (1).jpg | 2019-03-24 13:42 | 55K | |
![[IMG]](/icons/image2.gif) | 325.jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Tormod's Crypt (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Nantuko Shade (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Tainted Wood (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Arbor Colossus (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Palladium Myr (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Tendrils of Corruption (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Monk Idealist (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Containment Priest (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Fate Unraveler (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Coldsteel Heart (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Crib Swap (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Daxos the Returned (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Abyssal Persecutor (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Blatant Thievery (1).jpg | 2019-03-24 13:42 | 56K | |
![[IMG]](/icons/image2.gif) | Dreadbringer Lampads (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Banshee of the Dread Choir (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Trygon Predator (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Ghostblade Eidolon (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Fallen Ideal (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Kalemne's Captain (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Haunted Fengraf (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Fall of the Hammer (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Echoing Truth (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Ezuri's Predation (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Rapid Hybridization (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Daxos's Torment (1).jpg | 2019-03-24 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Desert Twister (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Viridian Shaman (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Spectral Procession (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Pestilence Demon (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Pearl Medallion (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Crypt Ghast (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Grisly Salvage (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Ghost Quarter (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Lorescale Coatl (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | 336.jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Ur-Golem's Eye (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Pontiff of Blight (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Dream Pillager (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Blade of Selves (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Novijen, Heart of Progress (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Talrand, Sky Summoner (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | 323.jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Indrik Stomphowler (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Great Oak Guardian (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Darksteel Citadel (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Steel Hellkite (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | Taurean Mauler (1).jpg | 2019-03-24 13:42 | 58K | |
![[IMG]](/icons/image2.gif) | 327.jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Charcoal Diamond (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Mizzium Mortars (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Cathodion (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Blustersquall (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Thornwood Falls (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Phyrexian Plaguelord (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | 335.jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Black Market (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Myr Sire (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Celestial Archon (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Dragon Mage (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Black Sun's Zenith (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Meren of Clan Nel Toth (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Wing Shards (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Viridian Emissary (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Stingerfling Spider (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Kalemne, Disciple of Iroas (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Bonehoard (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Marble Diamond (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Goblin Electromancer (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Sunblast Angel (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Snakeform (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Seal of Cleansing (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Emerald Medallion (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Altar's Reap (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Sever the Bloodline (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Plaxmanta (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Curse of the Nightly Hunt (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Fiery Confluence (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Skeletal Scrying (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Act of Aggression (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Ancient Amphitheater (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Treasury Thrull (1).jpg | 2019-03-24 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Kessig Cagebreakers (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Infernal Offering (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Kaseto, Orochi Archmage (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Patagia Viper (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Underworld Coinsmith (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Urza's Incubator (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Borderland Behemoth (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Phyrexian Rager (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | 332.jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Arjun, the Shifting Flame (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Grave Titan (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Oran-Rief, the Vastwood (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Crypt of Agadeem (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Gift of Estates (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Gisela, Blade of Goldnight (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Aether Snap (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Wistful Selkie (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Celestial Ancient (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Mulch (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Seal of the Guildpact (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Magus of the Coffers (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Raving Dead (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Warchief Giant (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Bad Moon (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Simic Keyrune (1).jpg | 2019-03-24 13:42 | 60K | |
![[IMG]](/icons/image2.gif) | Corpse Augur (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Sapphire Medallion (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Ob Nixilis of the Black Oath (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Ruby Medallion (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | 333.jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Twilight Shepherd (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Bosh, Iron Golem (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Seal of Doom (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Vandalblast (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Sphinx of Jwar Isle (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Everglades (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Skyhunter Skirmisher (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Trading Post (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Ohran Viper (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Sleep (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Profane Command (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Mystic Snake (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Desperate Ravings (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Ezuri, Claw of Progress (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Awaken the Sky Tyrant (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Golgari Charm (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Stinkdrinker Daredevil (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Korozda Guildmage (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Caller of the Claw (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Gargoyle Castle (1).jpg | 2019-03-24 13:42 | 61K | |
![[IMG]](/icons/image2.gif) | Mentor of the Meek (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Drana, Kalastria Bloodchief (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Mizzix of the Izmagnus (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Overseer of the Damned (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Llanowar Elves (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Pentavus (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Anya, Merciless Angel (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Moss Diamond (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Firemind's Foresight (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Polluted Mire (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Requiem Angel (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Bloodgift Demon (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Promise of Power (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Thran Dynamo (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Fire Diamond (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Hamletback Goliath (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Disciple of Bolas (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Magus of the Wheel (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Coiling Oracle (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Midnight Haunting (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Sun Titan (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Urza's Rage (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Flesh Carver (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Loaming Shaman (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Benevolent Offering (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Serra Angel (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Caged Sun (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Meteor Blast (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Eldrazi Monument (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Sacred Mesa (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Unstable Obelisk (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Spinerock Knoll (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Ajani's Chosen (1).jpg | 2019-03-24 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | Assault Suit (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Myriad Landscape (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Myr Retriever (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Great Furnace (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Tectonic Edge (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Argentum Armor (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Bloodspore Thrinax (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Intellectual Offering (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Jalum Tome (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Karlov of the Ghost Council (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Mazirek, Kraul Death Priest (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Sword of Vengeance (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Commander's Sphere (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Satyr Wayfinder (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Wall of Blossoms (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Jarad, Golgari Lich Lord (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Sky Diamond (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Tragic Slip (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Diabolic Servitude (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Loreseeker's Stone (1).jpg | 2019-03-24 13:42 | 63K | |
![[IMG]](/icons/image2.gif) | Synthetic Destiny (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Mycoloth (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Mirror Match (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Stoneshock Giant (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Pathbreaker Ibex (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Silverblade Paladin (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Biomantic Mastery (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Evernight Shade (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Counterflux (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Thundercloud Shaman (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Cloudthresher (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Collective Unconscious (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Sunrise Sovereign (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Arachnogenesis (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Concentrate (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Broodbirth Viper (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Decree of Justice (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Remote Isle (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Harrow (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Ghoulcaller Gisa (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Illusory Ambusher (1).jpg | 2019-03-24 13:42 | 64K | |
![[IMG]](/icons/image2.gif) | Malicious Affliction (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Cathars' Crusade (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Celestial Crusader (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Armistice (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Ninja of the Deep Hours (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Epic Experiment (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Grim Flowering (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Hallowed Spiritkeeper (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Dregs of Sorrow (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Nekrataal (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Noble Quarry (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Tornado Elemental (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Azure Mage (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Primal Growth (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Verdant Force (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Mask of Memory (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Martial Coup (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Necromancer's Covenant (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Dread Return (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Condemn (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Angelic Field Marshal (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Primordial Sage (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Vampire Hexmage (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | White Sun's Zenith (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Morkrut Banshee (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Orzhov Guildmage (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Exclude (1).jpg | 2019-03-24 13:42 | 65K | |
![[IMG]](/icons/image2.gif) | Melek, Izzet Paragon (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Pongify (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Everflowing Chalice (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Etherium-Horn Sorcerer (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Wolfbriar Elemental (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Mutilate (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Dormant Volcano (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Prime Speaker Zegana (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Necromantic Selection (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Ichor Wellspring (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Comeuppance (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Nomads' Assembly (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Bottle Gnomes (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Mizzix's Mastery (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Nahiri, the Lithomancer (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Burnished Hart (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Thought Reflection (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Junk Diver (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Coral Atoll (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Freyalise, Llanowar's Fury (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Ixidron (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Hunted Dragon (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Crown of Doom (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Cyclonic Rift (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Skirsdag High Priest (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Mobilization (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Kor Sanctifiers (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Adarkar Valkyrie (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Reliquary Tower (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Crystal Vein (1).jpg | 2019-03-24 13:42 | 66K | |
![[IMG]](/icons/image2.gif) | Karoo (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Liquimetal Coating (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Vampire Nighthawk (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Doom Blade (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Desolation Giant (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Sign in Blood (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Elvish Visionary (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Hostility (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Infinite Reflection (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Worn Powerstone (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Elvish Mystic (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Deploy to the Front (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Dulcet Sirens (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Wellwisher (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Hammerfist Giant (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Steam Augury (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Liliana's Reaver (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Read the Bones (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Angel of the Dire Hour (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Island (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Overwhelming Stampede (1).jpg | 2019-03-24 13:42 | 67K | |
![[IMG]](/icons/image2.gif) | Overrun (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Loxodon Warhammer (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Whirlwind (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Teferi, Temporal Archmage (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Geist-Honored Monk (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Predator, Flagship (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Spoils of Blood (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Mycosynth Wellspring (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Kemba, Kha Regent (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Distorting Wake (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Buried Ruin (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Thunderfoot Baloth (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Fresh Meat (1).jpg | 2019-03-24 13:42 | 68K | |
![[IMG]](/icons/image2.gif) | Forgotten Ancient (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Fumiko the Lowblood (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Sol Ring (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Sylvan Safekeeper (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Barren Moor (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Mind Stone (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | 293.jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Emeria, the Sky Ruin (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Ezuri, Renegade Leader (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Aether Gale (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Grand Abolisher (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Joraga Warcaller (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Lightkeeper of Emeria (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Cackling Counterpart (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Fell the Mighty (1).jpg | 2019-03-24 13:42 | 69K | |
![[IMG]](/icons/image2.gif) | Rite of the Raging Storm (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Terastodon (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Sphinx of Magosi (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Gray Merchant of Asphodel (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Swamp (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Syphon Flesh (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Siege Behemoth (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Elvish Archdruid (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Blasphemous Act (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Marshal's Anthem (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Soul of the Harvest (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Xathrid Demon (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Shaper Parasite (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Praetor's Counsel (1).jpg | 2019-03-24 13:42 | 70K | |
![[IMG]](/icons/image2.gif) | Jazal Goldmane (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Secluded Steppe (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | True Conviction (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Essence Warden (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Plains (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Butcher of Malakir (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Harmonize (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Reiver Demon (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Wolfcaller's Howl (1).jpg | 2019-03-24 13:42 | 71K | |
![[IMG]](/icons/image2.gif) | Bojuka Bog (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Phyrexian Ingester (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Whitemane Lion (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Call to Mind (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Titania's Chosen (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Voice of All (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Brine Elemental (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Fallen Angel (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Jungle Basin (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Into the Roil (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Whipflare (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Thornweald Archer (1).jpg | 2019-03-24 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | Sylvan Ranger (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Reaper from the Abyss (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Rush of Knowledge (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Masterwork of Ingenuity (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Brave the Elements (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Frost Titan (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Bitter Feud (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Titania, Protector of Argoth (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Sewer Nemesis (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Magma Giant (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Path to Exile (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Strata Scythe (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Tyrant's Familiar (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Lonely Sandbar (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Reclamation Sage (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Reef Worm (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Sylvan Offering (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Word of Seizing (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Wave of Vitriol (1).jpg | 2019-03-24 13:42 | 73K | |
![[IMG]](/icons/image2.gif) | Grave Pact (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Demon of Wailing Agonies (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Drove of Elves (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Celestial Force (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Sphinx of Uthuun (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Fool's Demise (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Priest of Titania (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Scavenging Ooze (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Wall of Omens (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Daretti, Scrap Savant (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Timberwatch Elf (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Fog Bank (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Panic Spellbomb (1).jpg | 2019-03-24 13:42 | 74K | |
![[IMG]](/icons/image2.gif) | Ingot Chewer (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Rise from the Grave (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Wake the Dead (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Stormsurge Kraken (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Turn to Frog (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Masked Admirers (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Wurmcoil Engine (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Song of the Dryads (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Sea Gate Oracle (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Domineering Will (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Windborn Muse (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Orzhov Basilica (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Phyrexia's Core (1).jpg | 2019-03-24 13:42 | 75K | |
![[IMG]](/icons/image2.gif) | Stroke of Genius (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Command Tower (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Fathom Seer (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Hoverguard Sweepers (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Diabolic Tutor (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Gruul Turf (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Austere Command (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Nemesis Trap (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Minds Aglow (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Imperious Perfect (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Faithless Looting (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Necrogenesis (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Grave Sifter (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Soul Snare (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Well of Ideas (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Lorthos, the Tidemaker (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Jwar Isle Refuge (1).jpg | 2019-03-24 13:42 | 76K | |
![[IMG]](/icons/image2.gif) | Victimize (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Vivid Marsh (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Dimir Signet (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Azorius Guildmage (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Selesnya Guildmage (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Lashwrithe (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Stitcher Geralf (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Acidic Slime (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Ghostly Prison (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Prophetic Prism (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Willbender (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Avatar of Woe (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Relic Crush (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Scrap Mastery (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Zoetic Cavern (1).jpg | 2019-03-24 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | Monk Realist (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Prison Term (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Rupture Spire (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Homeward Path (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Magmaquake (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Deep-Sea Kraken (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Dreadship Reef (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Hoard-Smelter Dragon (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Breaching Leviathan (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Bogardan Hellkite (1).jpg | 2019-03-24 13:42 | 78K | |
![[IMG]](/icons/image2.gif) | Wood Elves (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Artisan of Kozilek (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Vulturous Zombie (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Archangel of Strife (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Wren's Run Packmaster (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Shared Trauma (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Vow of Duty (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Lys Alana Huntmaster (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Oblivion Ring (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Forest (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Cobra Trap (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Unnerve (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Hour of Reckoning (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Dread Cacodemon (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Warmonger Hellkite (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Gwyllion Hedge-Mage (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Tuktuk the Explorer (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Hex (1).jpg | 2019-03-24 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | Creeperhulk (1).jpg | 2019-03-24 13:42 | 80K | |
![[IMG]](/icons/image2.gif) | Spawnwrithe (1).jpg | 2019-03-24 13:42 | 80K | |
![[IMG]](/icons/image2.gif) | Crescendo of War (1).jpg | 2019-03-24 13:42 | 80K | |
![[IMG]](/icons/image2.gif) | Spurnmage Advocate (1).jpg | 2019-03-24 13:42 | 80K | |
![[IMG]](/icons/image2.gif) | Shattered Angel (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Incite Rebellion (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Dualcaster Mage (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Evolving Wilds (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Havenwood Battleground (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Garruk Wildspeaker (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Triskelavus (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Mountain (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Feldon of the Third Path (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Patron of the Nezumi (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Flamekin Village (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Angelic Arbiter (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Repulse (1).jpg | 2019-03-24 13:42 | 81K | |
![[IMG]](/icons/image2.gif) | Martyr's Bond (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Beastmaster Ascension (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Syphon Mind (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Buried Alive (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Vedalken Plotter (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Lifeblood Hydra (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Guard Gomazoa (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Orim's Thunder (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Immaculate Magistrate (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Darksteel Ingot (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Golgari Guildmage (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Razorjaw Oni (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Return to Dust (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Akoum Refuge (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Tranquil Thicket (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Vorosh, the Hunter (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Bathe in Light (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Kazandu Refuge (1).jpg | 2019-03-24 13:42 | 82K | |
![[IMG]](/icons/image2.gif) | Epochrasite (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | False Prophet (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Hunting Triad (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Afterlife (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Mother of Runes (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Nantuko Husk (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Arbiter of Knollridge (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Vivid Grove (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Vow of Wildness (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Temple of the False God (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Journey to Nowhere (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Riptide Survivor (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Memory Erosion (1).jpg | 2019-03-24 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | Krosan Tusker (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Skullclamp (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Fact or Fiction (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Bestial Menace (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Oblation (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Awakening Zone (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Angel of Despair (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Golgari Rot Farm (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Impact Resonance (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Hydra Omnivore (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Champion's Helm (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Righteous Cause (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Compulsive Research (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | Ghave, Guru of Spores (1).jpg | 2019-03-24 13:42 | 84K | |
![[IMG]](/icons/image2.gif) | 122.jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Rite of Replication (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Alliance of Arms (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Beetleback Chief (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Gravedigger (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Nucklavee (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Fleshbag Marauder (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Flusterstorm (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Troll Ascetic (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Collective Voyage (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Vow of Malice (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Sigil Captain (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Vow of Flight (1).jpg | 2019-03-24 13:42 | 85K | |
![[IMG]](/icons/image2.gif) | Oros, the Avenger (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Oblivion Stone (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Invigorate (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Fungal Reaches (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Goblin Welder (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Deadly Recluse (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Akroma's Vengeance (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Terramorphic Expanse (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Tribute to the Wild (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Duergar Hedge-Mage (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Mortivore (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Valley Rannet (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Boros Guildmage (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Kodama's Reach (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Call the Skybreaker (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Solemn Simulacrum (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Gomazoa (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Brainstorm (1).jpg | 2019-03-24 13:42 | 86K | |
![[IMG]](/icons/image2.gif) | Colossal Might (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Riddlekeeper (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Dreamstone Hedron (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Congregate (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Izzet Boilerworks (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Jotun Grunt (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Svogthos, the Restless Tomb (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Volcanic Offering (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Armillary Sphere (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Fire+Ice (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Mulldrifter (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Molten Slagheap (1).jpg | 2019-03-24 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | Boros Garrison (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Izzet Signet (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Riku of Two Reflections (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Cleansing Beam (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Scythe Specter (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Mortify (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Numot, the Devastator (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Dark Hatchling (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Brion Stoutarm (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Rakdos Carnarium (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Pollen Lullaby (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Desecrator Hag (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Ray of Command (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Vision Skeins (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Szadek, Lord of Secrets (1).jpg | 2019-03-24 13:42 | 88K | |
![[IMG]](/icons/image2.gif) | Skyscribing (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Wall of Denial (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Simic Growth Chamber (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Conundrum Sphinx (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Evincar's Justice (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Wrath of God (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Vivid Meadow (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Vengeful Rebirth (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Karador, Ghost Chieftain (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Disaster Radius (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Vish Kal, Blood Arbiter (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Fierce Empath (1).jpg | 2019-03-24 13:42 | 89K | |
![[IMG]](/icons/image2.gif) | Trench Gorger (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Court Hussar (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Comet Storm (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Death Mutation (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Animar, Soul of Elements (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Stitch Together (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Izzet Chronarch (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Dominus of Fealty (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Dreamborn Muse (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Eternal Witness (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Attrition (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Spell Crumple (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Penumbra Spider (1).jpg | 2019-03-24 13:42 | 90K | |
![[IMG]](/icons/image2.gif) | Electrolyze (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Fellwar Stone (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Azorius Chancery (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Selesnya Evangel (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Brawn (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Rakdos Signet (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Lhurgoyf (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Avatar of Fury (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Death by Dragons (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Skullbriar, the Walking Grave (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Intet, the Dreamer (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Pyrohemia (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Bladewing the Risen (1).jpg | 2019-03-24 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | Aethersnipe (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Simic Signet (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Deadwood Treefolk (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Reins of Power (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Kaalia of the Vast (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Fists of Ironwood (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Symbiotic Wurm (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Vivid Creek (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Sakura-Tribe Elder (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Orzhov Signet (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Stranglehold (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Edric, Spymaster of Trest (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Shriekmaw (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Propaganda (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Vivid Crag (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Windfall (1).jpg | 2019-03-24 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | Chorus of the Conclave (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Damia, Sage of Stone (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Storm Herd (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Footbottom Feast (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Malfegor (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Hornet Queen (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Baloth Woodcrasher (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Chaos Warp (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Master Warcraft (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Yavimaya Elder (1).jpg | 2019-03-24 13:42 | 93K | |
![[IMG]](/icons/image2.gif) | Spike Feeder (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Nezumi Graverobber (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Wrexial, the Risen Deep (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Nin, the Pain Artist (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Dimir Aqueduct (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Punishing Fire (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Chartooth Cougar (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Elvish Aberration (1).jpg | 2019-03-24 13:42 | 94K | |
![[IMG]](/icons/image2.gif) | Squallmonger (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Forgotten Cave (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Living Death (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Basandra, Battle Seraph (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Selesnya Sanctuary (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Fertilid (1).jpg | 2019-03-24 13:42 | 95K | |
![[IMG]](/icons/image2.gif) | Hunting Pack (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Lightning Greaves (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Extractor Demon (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Flametongue Kavu (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Avatar of Slaughter (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Terminate (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Plumeveil (1).jpg | 2019-03-24 13:42 | 96K | |
![[IMG]](/icons/image2.gif) | Wonder (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Golgari Signet (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Ruination (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Faultgrinder (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Boros Signet (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Firespout (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Vow of Lightning (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Murmurs from Beyond (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Magus of the Vineyard (1).jpg | 2019-03-24 13:42 | 97K | |
![[IMG]](/icons/image2.gif) | Zedruu the Greathearted (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Simic Sky Swallower (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Gruul Signet (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Teneb, the Harvester (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Trade Secrets (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Furnace Whelp (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Opportunity (1).jpg | 2019-03-24 13:42 | 98K | |
![[IMG]](/icons/image2.gif) | Selesnya Signet (1).jpg | 2019-03-24 13:42 | 99K | |
![[IMG]](/icons/image2.gif) | Veteran Explorer (1).jpg | 2019-03-24 13:42 | 99K | |
![[IMG]](/icons/image2.gif) | Insurrection (1).jpg | 2019-03-24 13:42 | 99K | |
![[IMG]](/icons/image2.gif) | Whirlpool Whelm (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Akroma, Angel of Fury (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | 341.jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Scattering Stroke (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Acorn Catapult (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Cultivate (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Aquastrand Spider (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Ruhan of the Fomori (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | Rapacious One (1).jpg | 2019-03-24 13:42 | 100K | |
![[IMG]](/icons/image2.gif) | The Mimeoplasm (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Slipstream Eel (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Mana-Charged Dragon (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Savage Twister (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Tariel, Reckoner of Souls (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Wild Ricochet (1).jpg | 2019-03-24 13:42 | 101K | |
![[IMG]](/icons/image2.gif) | Magmatic Force (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Howling Mine (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Dragon Whelp (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Chain Reaction (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Earthquake (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Goblin Cadets (1).jpg | 2019-03-24 13:42 | 102K | |
![[IMG]](/icons/image2.gif) | Wrecking Ball (1).jpg | 2019-03-24 13:42 | 103K | |
![[IMG]](/icons/image2.gif) | Prophetic Bolt (1).jpg | 2019-03-24 13:42 | 103K | |
![[IMG]](/icons/image2.gif) | Perilous Research (1).jpg | 2019-03-24 13:42 | 104K | |
![[IMG]](/icons/image2.gif) | 342.jpg | 2019-03-24 13:42 | 105K | |
![[IMG]](/icons/image2.gif) | Breath of Darigaaz (1).jpg | 2019-03-24 13:42 | 105K | |
![[IMG]](/icons/image2.gif) | Aura Shards (1).jpg | 2019-03-24 13:42 | 106K | |
![[IMG]](/icons/image2.gif) | Anger (1).jpg | 2019-03-24 13:42 | 106K | |
![[IMG]](/icons/image2.gif) | 346.jpg | 2019-03-24 13:42 | 106K | |
![[IMG]](/icons/image2.gif) | Lash Out (1).jpg | 2019-03-24 13:42 | 107K | |
![[IMG]](/icons/image2.gif) | Explosive Vegetation (1).jpg | 2019-03-24 13:42 | 108K | |
![[IMG]](/icons/image2.gif) | Hull Breach (1).jpg | 2019-03-24 13:42 | 109K | |
![[IMG]](/icons/image2.gif) | Sulfurous Blast (1).jpg | 2019-03-24 13:42 | 109K | |
![[IMG]](/icons/image2.gif) | 350.jpg | 2019-03-24 13:42 | 109K | |
![[IMG]](/icons/image2.gif) | Boros Guildgate (1).jpg | 2019-03-24 13:42 | 109K | |
![[IMG]](/icons/image2.gif) | Mnemonic Wall (1).jpg | 2019-03-24 13:42 | 111K | |
![[IMG]](/icons/image2.gif) | Spitebellows (1).jpg | 2019-03-24 13:42 | 111K | |
![[IMG]](/icons/image2.gif) | Curse of the Forsaken (1).jpg | 2019-03-24 13:42 | 111K | |
![[IMG]](/icons/image2.gif) | Pristine Talisman (1).jpg | 2019-03-24 13:42 | 111K | |
![[IMG]](/icons/image2.gif) | Oni of Wild Places (1).jpg | 2019-03-24 13:42 | 112K | |
![[IMG]](/icons/image2.gif) | Sanguine Bond (1).jpg | 2019-03-24 13:42 | 113K | |
![[IMG]](/icons/image2.gif) | 343.jpg | 2019-03-24 13:42 | 114K | |
![[IMG]](/icons/image2.gif) | Famine (1).jpg | 2019-03-24 13:42 | 114K | |
![[IMG]](/icons/image2.gif) | Chromeshell Crab (1).jpg | 2019-03-24 13:42 | 114K | |
![[IMG]](/icons/image2.gif) | 354.jpg | 2019-03-24 13:42 | 114K | |
![[IMG]](/icons/image2.gif) | 352.jpg | 2019-03-24 13:42 | 115K | |
![[IMG]](/icons/image2.gif) | Basalt Monolith (1).jpg | 2019-03-24 13:42 | 115K | |
![[IMG]](/icons/image2.gif) | 339.jpg | 2019-03-24 13:42 | 115K | |
![[IMG]](/icons/image2.gif) | Tempt with Glory (1).jpg | 2019-03-24 13:42 | 115K | |
![[IMG]](/icons/image2.gif) | Divinity of Pride (1).jpg | 2019-03-24 13:42 | 115K | |
![[IMG]](/icons/image2.gif) | Obelisk of Esper (1).jpg | 2019-03-24 13:42 | 115K | |
![[IMG]](/icons/image2.gif) | Wash Out (1).jpg | 2019-03-24 13:42 | 116K | |
![[IMG]](/icons/image2.gif) | KJ51KF~D.JPG | 2019-03-24 13:42 | 116K | |
![[IMG]](/icons/image2.gif) | Control Magic (1).jpg | 2019-03-24 13:42 | 116K | |
![[IMG]](/icons/image2.gif) | Serra Avatar (1).jpg | 2019-03-24 13:42 | 116K | |
![[IMG]](/icons/image2.gif) | Blue Sun's Zenith (1).jpg | 2019-03-24 13:42 | 116K | |
![[IMG]](/icons/image2.gif) | Eternal Dragon (1).jpg | 2019-03-24 13:42 | 116K | |
![[IMG]](/icons/image2.gif) | Carnage Altar (1).jpg | 2019-03-24 13:42 | 117K | |
![[IMG]](/icons/image2.gif) | Prosperity (1).jpg | 2019-03-24 13:42 | 117K | |
![[IMG]](/icons/image2.gif) | 351.jpg | 2019-03-24 13:42 | 117K | |
![[IMG]](/icons/image2.gif) | Darksteel Mutation (1).jpg | 2019-03-24 13:42 | 117K | |
![[IMG]](/icons/image2.gif) | Kirtar's Wrath (1).jpg | 2019-03-24 13:42 | 118K | |
![[IMG]](/icons/image2.gif) | Curse of Inertia (1).jpg | 2019-03-24 13:42 | 118K | |
![[IMG]](/icons/image2.gif) | Djinn of Infinite Deceits (1).jpg | 2019-03-24 13:42 | 118K | |
![[IMG]](/icons/image2.gif) | Plains2 (1).jpg | 2019-03-24 13:42 | 118K | |
![[IMG]](/icons/image2.gif) | Mystic Barrier (1).jpg | 2019-03-24 13:42 | 118K | |
![[IMG]](/icons/image2.gif) | 348.jpg | 2019-03-24 13:42 | 118K | |
![[IMG]](/icons/image2.gif) | Faerie Conclave (1).jpg | 2019-03-24 13:42 | 119K | |
![[IMG]](/icons/image2.gif) | Arcane Melee (1).jpg | 2019-03-24 13:42 | 119K | |
![[IMG]](/icons/image2.gif) | Viscera Seer (1).jpg | 2019-03-24 13:42 | 119K | |
![[IMG]](/icons/image2.gif) | Curse of Shallow Graves (1).jpg | 2019-03-24 13:42 | 120K | |
![[IMG]](/icons/image2.gif) | Drifting Meadow (1).jpg | 2019-03-24 13:42 | 120K | |
![[IMG]](/icons/image2.gif) | Brilliant Plan (1).jpg | 2019-03-24 13:42 | 120K | |
![[IMG]](/icons/image2.gif) | 340.jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Survival Cache (1).jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Jund Panorama (1).jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Raven Familiar (1).jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Dimir Guildgate (1).jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Tidal Force (1).jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Languish (1).jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Phyrexian Gargantua (1).jpg | 2019-03-24 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | Angel of Finality (1).jpg | 2019-03-24 13:42 | 122K | |
![[IMG]](/icons/image2.gif) | Night Soil (1).jpg | 2019-03-24 13:42 | 122K | |
![[IMG]](/icons/image2.gif) | Bant Panorama (1).jpg | 2019-03-24 13:42 | 122K | |
![[IMG]](/icons/image2.gif) | Sun Droplet (1).jpg | 2019-03-24 13:42 | 122K | |
![[IMG]](/icons/image2.gif) | Dismiss (1).jpg | 2019-03-24 13:42 | 123K | |
![[IMG]](/icons/image2.gif) | Azorius Herald (1).jpg | 2019-03-24 13:42 | 123K | |
![[IMG]](/icons/image2.gif) | Obelisk of Jund (1).jpg | 2019-03-24 13:42 | 123K | |
![[IMG]](/icons/image2.gif) | 345.jpg | 2019-03-24 13:42 | 123K | |
![[IMG]](/icons/image2.gif) | Razor Hippogriff (1).jpg | 2019-03-24 13:42 | 123K | |
![[IMG]](/icons/image2.gif) | Baleful Force (1).jpg | 2019-03-24 13:42 | 123K | |
![[IMG]](/icons/image2.gif) | Restore (1).jpg | 2019-03-24 13:42 | 123K | |
![[IMG]](/icons/image2.gif) | Hooded Horror (1).jpg | 2019-03-24 13:42 | 124K | |
![[IMG]](/icons/image2.gif) | 338.jpg | 2019-03-24 13:42 | 124K | |
![[IMG]](/icons/image2.gif) | Unexpectedly Absent (1).jpg | 2019-03-24 13:42 | 124K | |
![[IMG]](/icons/image2.gif) | Plains3 (1).jpg | 2019-03-24 13:42 | 124K | |
![[IMG]](/icons/image2.gif) | Spine of Ish Sah (1).jpg | 2019-03-24 13:42 | 124K | |
![[IMG]](/icons/image2.gif) | 356.jpg | 2019-03-24 13:42 | 124K | |
![[IMG]](/icons/image2.gif) | Wight of Precinct Six (1).jpg | 2019-03-24 13:42 | 125K | |
![[IMG]](/icons/image2.gif) | Vizkopa Guildmage (1).jpg | 2019-03-24 13:42 | 125K | |
![[IMG]](/icons/image2.gif) | Jar of Eyeballs (1).jpg | 2019-03-24 13:42 | 125K | |
![[IMG]](/icons/image2.gif) | Phyrexian Delver (1).jpg | 2019-03-24 13:42 | 126K | |
![[IMG]](/icons/image2.gif) | Dirge of Dread (1).jpg | 2019-03-24 13:42 | 126K | |
![[IMG]](/icons/image2.gif) | Serene Master (1).jpg | 2019-03-24 13:42 | 126K | |
![[IMG]](/icons/image2.gif) | Flickerwisp (1).jpg | 2019-03-24 13:42 | 126K | |
![[IMG]](/icons/image2.gif) | New Benalia (1).jpg | 2019-03-24 13:42 | 126K | |
![[IMG]](/icons/image2.gif) | Sudden Spoiling (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Azorius Keyrune (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Fell Shepherd (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Sejiri Refuge (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Grim Backwoods (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Esper Panorama (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Island3 (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Contested Cliffs (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Stronghold Assassin (1).jpg | 2019-03-24 13:42 | 127K | |
![[IMG]](/icons/image2.gif) | Fires of Yavimaya (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Diviner Spirit (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Swamp1 (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Grixis Panorama (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Karmic Guide (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Order of Succession (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Filigree Angel (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Greed (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Crawlspace (1).jpg | 2019-03-24 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | Arcane Denial (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Thunderstaff (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Ophiomancer (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Behemoth Sledge (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Price of Knowledge (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Orzhov Guildgate (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Toxic Deluge (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Dungeon Geists (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Borrowing 100,000 Arrows (1).jpg | 2019-03-24 13:42 | 129K | |
![[IMG]](/icons/image2.gif) | Strategic Planning (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Obelisk of Grixis (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Slippery Karst (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Azorius Guildgate (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Echo Mage (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Marrow Bats (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Disciple of Griselbrand (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Krosan Warchief (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Deceiver Exarch (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Decree of Pain (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Arcane Sanctum (1).jpg | 2019-03-24 13:42 | 130K | |
![[IMG]](/icons/image2.gif) | Viseling (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Conjurer's Closet (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Fiery Justice (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Curse of Predation (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Mirari (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Infest (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Cradle of Vitality (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Quagmire Druid (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Act of Authority (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Island1 (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Mistmeadow Witch (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Thornwind Faeries (1).jpg | 2019-03-24 13:42 | 131K | |
![[IMG]](/icons/image2.gif) | Plains1 (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Starstorm (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Pilgrim's Eye (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Presence of Gond (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Nekusar, the Mindrazer (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Sangromancer (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Surveyor's Scope (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Deep Analysis (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Spelltwine (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Island2 (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Winged Coatl (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Hada Spy Patrol (1).jpg | 2019-03-24 13:42 | 132K | |
![[IMG]](/icons/image2.gif) | Saltcrusted Steppe (1).jpg | 2019-03-24 13:42 | 133K | |
![[IMG]](/icons/image2.gif) | Thousand-Year Elixir (1).jpg | 2019-03-24 13:42 | 133K | |
![[IMG]](/icons/image2.gif) | Tempt with Reflections (1).jpg | 2019-03-24 13:42 | 133K | |
![[IMG]](/icons/image2.gif) | Izzet Guildgate (1).jpg | 2019-03-24 13:42 | 133K | |
![[IMG]](/icons/image2.gif) | Augury Adept (1).jpg | 2019-03-24 13:42 | 133K | |
![[IMG]](/icons/image2.gif) | Hua Tuo, Honored Physician (1).jpg | 2019-03-24 13:42 | 133K | |
![[IMG]](/icons/image2.gif) | Annihilate (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Jace's Archivist (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Ajani's Pridemate (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Gruul Guildgate (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Phantom Nantuko (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Augur of Bolas (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Swamp3 (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | True-Name Nemesis (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Sword of the Paruns (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Wayfarer's Bauble (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Tempt with Immortality (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Phyrexian Reclamation (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Llanowar Reborn (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Ravenous Baloth (1).jpg | 2019-03-24 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Eye of Doom (1).jpg | 2019-03-24 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | Murkfiend Liege (1).jpg | 2019-03-24 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | 353.jpg | 2019-03-24 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | Swiftfoot Boots (1).jpg | 2019-03-24 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | Swamp2 (1).jpg | 2019-03-24 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | Opal Palace (1).jpg | 2019-03-24 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | Jeleva, Nephalia's Scourge (1).jpg | 2019-03-24 13:42 | 135K | |
![[IMG]](/icons/image2.gif) | Curse of Vengeance (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Grixis Charm (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Wall of Reverence (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Crosis's Charm (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Tempt with Discovery (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Sunpetal Grove (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Selesnya Guildgate (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Rain of Thorns (1).jpg | 2019-03-24 13:42 | 136K | |
![[IMG]](/icons/image2.gif) | Mold Shambler (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Reincarnation (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Cruel Ultimatum (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Mountain3 (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Spellbreaker Behemoth (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Spiteful Visions (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Abzan Falconer (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Well of Lost Dreams (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Savage Lands (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Mountain1 (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Kher Keep (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Transguild Promenade (1).jpg | 2019-03-24 13:42 | 137K | |
![[IMG]](/icons/image2.gif) | Tower Gargoyle (1).jpg | 2019-03-24 13:42 | 138K | |
![[IMG]](/icons/image2.gif) | Sublime Exhalation (1).jpg | 2019-03-24 13:42 | 138K | |
![[IMG]](/icons/image2.gif) | Aerie Mystics (1).jpg | 2019-03-24 13:42 | 138K | |
![[IMG]](/icons/image2.gif) | Guttersnipe (1).jpg | 2019-03-24 13:42 | 138K | |
![[IMG]](/icons/image2.gif) | Stonecloaker (1).jpg | 2019-03-24 13:42 | 138K | |
![[IMG]](/icons/image2.gif) | Temple Bell (1).jpg | 2019-03-24 13:42 | 138K | |
![[IMG]](/icons/image2.gif) | Mountain2 (1).jpg | 2019-03-24 13:42 | 138K | |
![[IMG]](/icons/image2.gif) | Curse of Chaos (1).jpg | 2019-03-24 13:42 | 139K | |
![[IMG]](/icons/image2.gif) | Sharuum the Hegemon (1).jpg | 2019-03-24 13:42 | 139K | |
![[IMG]](/icons/image2.gif) | Baleful Strix (1).jpg | 2019-03-24 13:42 | 139K | |
![[IMG]](/icons/image2.gif) | Lurking Predators (1).jpg | 2019-03-24 13:42 | 139K | |
![[IMG]](/icons/image2.gif) | Rakdos Guildgate (1).jpg | 2019-03-24 13:42 | 139K | |
![[IMG]](/icons/image2.gif) | Rampaging Baloths (1).jpg | 2019-03-24 13:42 | 139K | |
![[IMG]](/icons/image2.gif) | Uyo, Silent Prophet (1).jpg | 2019-03-24 13:42 | 139K | |
![[IMG]](/icons/image2.gif) | Grazing Gladehart (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Scarland Thrinax (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Leafdrake Roost (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Tower of Fortunes (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Mirror Entity (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Underground River (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Kazandu Tuskcaller (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Simic Guildgate (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Utter End (1).jpg | 2019-03-24 13:42 | 140K | |
![[IMG]](/icons/image2.gif) | Forest1 (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Hushwing Gryff (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Illusionist's Gambit (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Lu Xun, Scholar General (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Nivix Guildmage (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Dromar's Charm (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Foster (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Dismal Backwater (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Azami, Lady of Scrolls (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Naya Panorama (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Tidehollow Strix (1).jpg | 2019-03-24 13:42 | 141K | |
![[IMG]](/icons/image2.gif) | Phthisis (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Fissure Vent (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Druidic Satchel (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Sandsteppe Citadel (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Archangel (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Trinket Mage (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Naya Charm (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Fiend Hunter (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Golgari Guildgate (1).jpg | 2019-03-24 13:42 | 142K | |
![[IMG]](/icons/image2.gif) | Aethermage's Touch (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Farhaven Elf (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Reckless Spite (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | LR3LTH~V.JPG | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Lim-Dul's Vault (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Nightscape Familiar (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Spoils of Victory (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Soul Manipulation (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Rakeclaw Gargantuan (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Nihil Spellbomb (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Vitu-Ghazi, the City-Tree (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Ash Barrens (1).jpg | 2019-03-24 13:42 | 143K | |
![[IMG]](/icons/image2.gif) | Leonin Bladetrap (1).jpg | 2019-03-24 13:42 | 144K | |
![[IMG]](/icons/image2.gif) | Cranial Plating (1).jpg | 2019-03-24 13:42 | 144K | |
![[IMG]](/icons/image2.gif) | Oloro, Ageless Ascetic (1).jpg | 2019-03-24 13:42 | 144K | |
![[IMG]](/icons/image2.gif) | Nevinyrral's Disk (1).jpg | 2019-03-24 13:42 | 144K | |
![[IMG]](/icons/image2.gif) | Seaside Citadel (1).jpg | 2019-03-24 13:42 | 144K | |
![[IMG]](/icons/image2.gif) | Witch Hunt (1).jpg | 2019-03-24 13:42 | 144K | |
![[IMG]](/icons/image2.gif) | Forest3 (1).jpg | 2019-03-24 13:42 | 145K | |
![[IMG]](/icons/image2.gif) | Stormscape Battlemage (1).jpg | 2019-03-24 13:42 | 145K | |
![[IMG]](/icons/image2.gif) | Naya Soulbeast (1).jpg | 2019-03-24 13:42 | 145K | |
![[IMG]](/icons/image2.gif) | Brooding Saurian (1).jpg | 2019-03-24 13:42 | 145K | |
![[IMG]](/icons/image2.gif) | Slice and Dice (1).jpg | 2019-03-24 13:42 | 145K | |
![[IMG]](/icons/image2.gif) | Selesnya Charm (1).jpg | 2019-03-24 13:42 | 145K | |
![[IMG]](/icons/image2.gif) | Primal Vigor (1).jpg | 2019-03-24 13:42 | 145K | |
![[IMG]](/icons/image2.gif) | Khalni Garden (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Flickerform (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Hunted Troll (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Sharding Sphinx (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Gahiji, Honored One (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Vile Requiem (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Smoldering Crater (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Prossh, Skyraider of Kher (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Duelist's Heritage (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Merciless Eviction (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Custodi Soulbinders (1).jpg | 2019-03-24 13:42 | 146K | |
![[IMG]](/icons/image2.gif) | Silklash Spider (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Slice in Twain (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Grand Coliseum (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Endrek Sahr, Master Breeder (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Swan Song (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Incendiary Command (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Urza's Factory (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Crumbling Necropolis (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Mirrorweave (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Forest2 (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Capricious Efreet (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Boros Charm (1).jpg | 2019-03-24 13:42 | 147K | |
![[IMG]](/icons/image2.gif) | Jungle Shrine (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Inferno Titan (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Blood Rites (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Shimmer Myr (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Rubinia Soulsinger (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Seer's Sundial (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Treasure Cruise (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Parting Thoughts (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Deathbringer Thoctar (1).jpg | 2019-03-24 13:42 | 148K | |
![[IMG]](/icons/image2.gif) | Myr Battlesphere (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Jund Charm (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Thopter Foundry (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Roon of the Hidden Realm (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Sphinx of the Steel Wind (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Sudden Demise (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Goblin Sharpshooter (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Derevi, Empyrial Tactician (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Shattergang Brothers (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Cauldron of Souls (1).jpg | 2019-03-24 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | Death Grasp (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Fecundity (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | War Cadence (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Skyward Eye Prophets (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Selfless Squire (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Fireball (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Kydele, Chosen of Kruphix (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Solidarity of Heroes (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Rugged Highlands (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Read the Runes (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Army of the Damned (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Springjack Pasture (1).jpg | 2019-03-24 13:42 | 150K | |
![[IMG]](/icons/image2.gif) | Bane of Progress (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Chain of Vapor (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Mosswort Bridge (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Inspiring Call (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Brutal Hordechief (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Magus of the Will (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Brave the Sands (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Bane of the Living (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Managorger Hydra (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Stalking Vengeance (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Kalonian Hydra (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Ravos, Soultender (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Caves of Koilos (1).jpg | 2019-03-24 13:42 | 151K | |
![[IMG]](/icons/image2.gif) | Swords to Plowshares (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Dragonskull Summit (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Tezzeret's Gambit (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Horizon Chimera (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Whispersilk Cloak (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Shamanic Revelation (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Mayael the Anima (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Corpsejack Menace (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Curtains' Call (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Benefactor's Draught (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Spinal Embrace (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Sphere of Safety (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Krosan Grip (1).jpg | 2019-03-24 13:42 | 152K | |
![[IMG]](/icons/image2.gif) | Charnelhoard Wurm (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Sphinx Summoner (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Keening Stone (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Endless Cockroaches (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | From the Ashes (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | One Dozen Eyes (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Marath, Will of the Wild (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Etherium Sculptor (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Manifold Insights (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Iroas, God of Victory (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Disdainful Stroke (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Thraximundar (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Prismatic Geoscope (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Blind Obedience (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Drumhunter (1).jpg | 2019-03-24 13:42 | 153K | |
![[IMG]](/icons/image2.gif) | Walker of the Grove (1).jpg | 2019-03-24 13:42 | 154K | |
![[IMG]](/icons/image2.gif) | Rana, the Bloodsower (1).jpg | 2019-03-24 13:42 | 154K | |
![[IMG]](/icons/image2.gif) | Abzan Charm (1).jpg | 2019-03-24 13:42 | 154K | |
![[IMG]](/icons/image2.gif) | Plague Boiler (1).jpg | 2019-03-24 13:42 | 154K | |
![[IMG]](/icons/image2.gif) | Chasm Skulker (1).jpg | 2019-03-24 13:42 | 154K | |
![[IMG]](/icons/image2.gif) | Enduring Scalelord (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Sungrass Prairie (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Mystic Monastery (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Beacon of Unrest (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Deepglow Skate (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Ghastly Conscription (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Terra Ravager (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Empyrial Plate (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Forbidden Orchard (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Spawning Grounds (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | Grave Upheaval (1).jpg | 2019-03-24 13:42 | 155K | |
![[IMG]](/icons/image2.gif) | In Garruk's Wake (1).jpg | 2019-03-24 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Shadowblood Ridge (1).jpg | 2019-03-24 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Hardened Scales (1).jpg | 2019-03-24 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Charmbreaker Devils (1).jpg | 2019-03-24 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Ancient Excavation (1).jpg | 2019-03-24 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Gamekeeper (1).jpg | 2019-03-24 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Bruse Tarl, Boorish Herder (1).jpg | 2019-03-24 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Boompile (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Migratory Route (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Sprouting Thrinax (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Vedalken Engineer (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Astral Cornucopia (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Sanctum Gargoyle (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Den Protector (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Citadel Siege (1).jpg | 2019-03-24 13:42 | 157K | |
![[IMG]](/icons/image2.gif) | Jade Mage (1).jpg | 2019-03-24 13:42 | 158K | |
![[IMG]](/icons/image2.gif) | Where Ancients Tread (1).jpg | 2019-03-24 13:42 | 158K | |
![[IMG]](/icons/image2.gif) | Whims of the Fates (1).jpg | 2019-03-24 13:42 | 158K | |
![[IMG]](/icons/image2.gif) | Clan Defiance (1).jpg | 2019-03-24 13:42 | 158K | |
![[IMG]](/icons/image2.gif) | Etched Oracle (1).jpg | 2019-03-24 13:42 | 158K | |
![[IMG]](/icons/image2.gif) | Warstorm Surge (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Worm Harvest (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Grip of Phyresis (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Coastal Breach (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Tuskguard Captain (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Phyrexian Rebirth (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Magus of the Arena (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Deepfire Elemental (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Thrummingbird (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Murmuring Bosk (1).jpg | 2019-03-24 13:42 | 159K | |
![[IMG]](/icons/image2.gif) | Atraxa, Praetors' Voice (1).jpg | 2019-03-24 13:42 | 160K | |
![[IMG]](/icons/image2.gif) | Entrapment Maneuver (1).jpg | 2019-03-24 13:42 | 160K | |
![[IMG]](/icons/image2.gif) | Street Spasm (1).jpg | 2019-03-24 13:42 | 160K | |
![[IMG]](/icons/image2.gif) | Gwafa Hazid, Profiteer (1).jpg | 2019-03-24 13:42 | 160K | |
![[IMG]](/icons/image2.gif) | Evacuation (1).jpg | 2019-03-24 13:42 | 160K | |
![[IMG]](/icons/image2.gif) | Chromatic Lantern (1).jpg | 2019-03-24 13:42 | 160K | |
![[IMG]](/icons/image2.gif) | Tooth and Claw (1).jpg | 2019-03-24 13:42 | 160K | |
![[IMG]](/icons/image2.gif) | Sylvan Reclamation (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Armory Automaton (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Sydri, Galvanic Genius (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Elvish Skysweeper (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Waste Not (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Bred for the Hunt (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Opulent Palace (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Wild Beastmaster (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Frontier Bivouac (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Executioner's Capsule (1).jpg | 2019-03-24 13:42 | 161K | |
![[IMG]](/icons/image2.gif) | Sek'Kuar, Deathkeeper (1).jpg | 2019-03-24 13:42 | 162K | |
![[IMG]](/icons/image2.gif) | Nomad Outpost (1).jpg | 2019-03-24 13:42 | 162K | |
![[IMG]](/icons/image2.gif) | Molten Disaster (1).jpg | 2019-03-24 13:42 | 162K | |
![[IMG]](/icons/image2.gif) | Evolutionary Escalation (1).jpg | 2019-03-24 13:42 | 162K | |
![[IMG]](/icons/image2.gif) | Widespread Panic (1).jpg | 2019-03-24 13:42 | 162K | |
![[IMG]](/icons/image2.gif) | Akiri, Line-Slinger (1).jpg | 2019-03-24 13:42 | 162K | |
![[IMG]](/icons/image2.gif) | Spellheart Chimera (1).jpg | 2019-03-24 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | Silas Renn, Seeker Adept (1).jpg | 2019-03-24 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | Mass Mutiny (1).jpg | 2019-03-24 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | Cruel Entertainment (1).jpg | 2019-03-24 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | Rootbound Crag (1).jpg | 2019-03-24 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | Burgeoning (1).jpg | 2019-03-24 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | Zhur-Taa Druid (1).jpg | 2019-03-24 13:42 | 163K | |
![[IMG]](/icons/image2.gif) | Primeval Protector (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Elite Scaleguard (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Ikra Shidiqi, the Usurper (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Chief Engineer (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Avenger of Zendikar (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Rakdos Charm (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Reveillark (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Glint-Eye Nephilim (1).jpg | 2019-03-24 13:42 | 164K | |
![[IMG]](/icons/image2.gif) | Progenitor Mimic (1).jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | Rites of Flourishing (1).jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | Festercreep (1).jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | Darkwater Catacombs (1).jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | 118a.jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | 118b.jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | Rough+Tumble (1).jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | Master of Etherium (1).jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | Akroan Horse (1).jpg | 2019-03-24 13:42 | 165K | |
![[IMG]](/icons/image2.gif) | Crystalline Crawler (1).jpg | 2019-03-24 13:42 | 166K | |
![[IMG]](/icons/image2.gif) | Wave of Reckoning (1).jpg | 2019-03-24 13:42 | 166K | |
![[IMG]](/icons/image2.gif) | Faerie Artisans (1).jpg | 2019-03-24 13:42 | 166K | |
![[IMG]](/icons/image2.gif) | Ethersworn Adjudicator (1).jpg | 2019-03-24 13:42 | 166K | |
![[IMG]](/icons/image2.gif) | Sunforger (1).jpg | 2019-03-24 13:42 | 166K | |
![[IMG]](/icons/image2.gif) | Sprouting Vines (1).jpg | 2019-03-24 13:42 | 166K | |
![[IMG]](/icons/image2.gif) | Juniper Order Ranger (1).jpg | 2019-03-24 13:42 | 166K | |
![[IMG]](/icons/image2.gif) | Jor Kadeen, the Prevailer (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Krosan Verge (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Dispeller's Capsule (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Dauntless Escort (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Conqueror's Flail (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Reverse the Sands (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Venser's Journal (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Charging Cinderhorn (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Crater Hellion (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Hellkite Igniter (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Sidar Kondo of Jamuraa (1).jpg | 2019-03-24 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | Seeds of Renewal (1).jpg | 2019-03-24 13:42 | 168K | |
![[IMG]](/icons/image2.gif) | Blood Tyrant (1).jpg | 2019-03-24 13:42 | 168K | |
![[IMG]](/icons/image2.gif) | Fathom Mage (1).jpg | 2019-03-24 13:42 | 168K | |
![[IMG]](/icons/image2.gif) | Tymna the Weaver (1).jpg | 2019-03-24 13:42 | 169K | |
![[IMG]](/icons/image2.gif) | Blazing Archon (1).jpg | 2019-03-24 13:42 | 169K | |
![[IMG]](/icons/image2.gif) | Soul of New Phyrexia (1).jpg | 2019-03-24 13:42 | 169K | |
![[IMG]](/icons/image2.gif) | Kraum, Ludevic's Opus (1).jpg | 2019-03-24 13:42 | 169K | |
![[IMG]](/icons/image2.gif) | Ishai, Ojutai Dragonspeaker (1).jpg | 2019-03-24 13:42 | 169K | |
![[IMG]](/icons/image2.gif) | Goblin Bombardment (1).jpg | 2019-03-24 13:42 | 169K | |
![[IMG]](/icons/image2.gif) | Tempt with Vengeance (1).jpg | 2019-03-24 13:42 | 170K | |
![[IMG]](/icons/image2.gif) | Thrasios, Triton Hero (1).jpg | 2019-03-24 13:42 | 170K | |
![[IMG]](/icons/image2.gif) | Crackling Doom (1).jpg | 2019-03-24 13:42 | 170K | |
![[IMG]](/icons/image2.gif) | Orzhov Advokist (1).jpg | 2019-03-24 13:42 | 171K | |
![[IMG]](/icons/image2.gif) | Duneblast (1).jpg | 2019-03-24 13:42 | 171K | |
![[IMG]](/icons/image2.gif) | Volcanic Vision (1).jpg | 2019-03-24 13:42 | 172K | |
![[IMG]](/icons/image2.gif) | Humble Defector (1).jpg | 2019-03-24 13:42 | 172K | |
![[IMG]](/icons/image2.gif) | Blinkmoth Urn (1).jpg | 2019-03-24 13:42 | 172K | |
![[IMG]](/icons/image2.gif) | Reforge the Soul (1).jpg | 2019-03-24 13:42 | 172K | |
![[IMG]](/icons/image2.gif) | Decimate (1).jpg | 2019-03-24 13:42 | 172K | |
![[IMG]](/icons/image2.gif) | Champion of Lambholt (1).jpg | 2019-03-24 13:42 | 172K | |
![[IMG]](/icons/image2.gif) | Reyhan, Last of the Abzan (1).jpg | 2019-03-24 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | Guiltfeeder (1).jpg | 2019-03-24 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | Tana, the Bloodsower (1).jpg | 2019-03-24 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | Nash of the Gilt-Leaf (1).jpg | 2019-03-24 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | Hoofprints of the Stag (1).jpg | 2019-03-24 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | Consuming Aberration (1).jpg | 2019-03-24 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | Hellkite Tyrant (1).jpg | 2019-03-24 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | Stonehoof Chieftain (1).jpg | 2019-03-24 13:42 | 174K | |
![[IMG]](/icons/image2.gif) | Windbrisk Heights (1).jpg | 2019-03-24 13:42 | 174K | |
![[IMG]](/icons/image2.gif) | Far Wanderings (1).jpg | 2019-03-24 13:42 | 174K | |
![[IMG]](/icons/image2.gif) | Sylvok Explorer (1).jpg | 2019-03-24 13:42 | 174K | |
![[IMG]](/icons/image2.gif) | Seat of the Synod (1).jpg | 2019-03-24 13:42 | 175K | |
![[IMG]](/icons/image2.gif) | Treacherous Terrain (1).jpg | 2019-03-24 13:42 | 175K | |
![[IMG]](/icons/image2.gif) | Whispering Madness (1).jpg | 2019-03-24 13:42 | 175K | |
![[IMG]](/icons/image2.gif) | Hanna, Ship's Navigator (1).jpg | 2019-03-24 13:42 | 175K | |
![[IMG]](/icons/image2.gif) | Kynaios and Tiro of Meletis (1).jpg | 2019-03-24 13:42 | 175K | |
![[IMG]](/icons/image2.gif) | Frenzied Fugue (1).jpg | 2019-03-24 13:42 | 175K | |
![[IMG]](/icons/image2.gif) | Academy Elite (1).jpg | 2019-03-24 13:42 | 176K | |
![[IMG]](/icons/image2.gif) | Aeon Chronicler (1).jpg | 2019-03-24 13:42 | 176K | |
![[IMG]](/icons/image2.gif) | Ankle Shanker (1).jpg | 2019-03-24 13:42 | 176K | |
![[IMG]](/icons/image2.gif) | Selvala, Explorer Returned (1).jpg | 2019-03-24 13:42 | 176K | |
![[IMG]](/icons/image2.gif) | Saskia the Unyielding (1).jpg | 2019-03-24 13:42 | 176K | |
![[IMG]](/icons/image2.gif) | Beast Within (1).jpg | 2019-03-24 13:42 | 176K | |
![[IMG]](/icons/image2.gif) | Rubblehulk (1).jpg | 2019-03-24 13:42 | 176K | |
![[IMG]](/icons/image2.gif) | Wilderness Elemental (1).jpg | 2019-03-24 13:42 | 177K | |
![[IMG]](/icons/image2.gif) | Everlasting Torment (1).jpg | 2019-03-24 13:42 | 177K | |
![[IMG]](/icons/image2.gif) | Divergent Transformations (1).jpg | 2019-03-24 13:42 | 177K | |
![[IMG]](/icons/image2.gif) | Furnace Celebration (1).jpg | 2019-03-24 13:42 | 177K | |
![[IMG]](/icons/image2.gif) | Realm Seekers (1).jpg | 2019-03-24 13:42 | 177K | |
![[IMG]](/icons/image2.gif) | Ludevic, Necro-Alchemist (1).jpg | 2019-03-24 13:42 | 178K | |
![[IMG]](/icons/image2.gif) | Bituminous Blast (1).jpg | 2019-03-24 13:42 | 178K | |
![[IMG]](/icons/image2.gif) | Breya, Etherium Shaper (1).jpg | 2019-03-24 13:42 | 178K | |
![[IMG]](/icons/image2.gif) | Karplusan Forest (1).jpg | 2019-03-24 13:42 | 178K | |
![[IMG]](/icons/image2.gif) | Past in Flames (1).jpg | 2019-03-24 13:42 | 179K | |
![[IMG]](/icons/image2.gif) | Runehorn Hellkite (1).jpg | 2019-03-24 13:42 | 179K | |
![[IMG]](/icons/image2.gif) | Goblin Spymaster (1).jpg | 2019-03-24 13:42 | 180K | |
![[IMG]](/icons/image2.gif) | Devastation Tide (1).jpg | 2019-03-24 13:42 | 180K | |
![[IMG]](/icons/image2.gif) | Alesha, Who Smiles at Death (1).jpg | 2019-03-24 13:42 | 181K | |
![[IMG]](/icons/image2.gif) | Vial Smasher the Fierce (1).jpg | 2019-03-24 13:42 | 181K | |
![[IMG]](/icons/image2.gif) | Vorel of the Hull Clade (1).jpg | 2019-03-24 13:42 | 181K | |
![[IMG]](/icons/image2.gif) | Slobad, Goblin Tinkerer (1).jpg | 2019-03-24 13:42 | 181K | |
![[IMG]](/icons/image2.gif) | Spitting Image (1).jpg | 2019-03-24 13:42 | 181K | |
![[IMG]](/icons/image2.gif) | Kazuul, Tyrant of the Cliffs (1).jpg | 2019-03-24 13:42 | 183K | |
![[IMG]](/icons/image2.gif) | Trash for Treasure (1).jpg | 2019-03-24 13:42 | 183K | |
![[IMG]](/icons/image2.gif) | Wheel of Fate (1).jpg | 2019-03-24 13:42 | 183K | |
![[IMG]](/icons/image2.gif) | Master Biomancer (1).jpg | 2019-03-24 13:42 | 183K | |
![[IMG]](/icons/image2.gif) | Artifact Mutation (1).jpg | 2019-03-24 13:42 | 185K | |
![[IMG]](/icons/image2.gif) | Godo, Bandit Warlord (1).jpg | 2019-03-24 13:42 | 185K | |
![[IMG]](/icons/image2.gif) | Bloodbraid Elf (1).jpg | 2019-03-24 13:42 | 185K | |
![[IMG]](/icons/image2.gif) | Exotic Orchard (1).jpg | 2019-03-24 13:42 | 187K | |
![[IMG]](/icons/image2.gif) | Breath of Fury (1).jpg | 2019-03-24 13:42 | 189K | |
![[IMG]](/icons/image2.gif) | Yidris, Maelstrom Wielder (1).jpg | 2019-03-24 13:42 | 189K | |
![[IMG]](/icons/image2.gif) | Quirion Explorer (1).jpg | 2019-03-24 13:42 | 189K | |
![[IMG]](/icons/image2.gif) | Farseek (1).jpg | 2019-03-24 13:42 | 191K | |
![[IMG]](/icons/image2.gif) | Aura Mutation (1).jpg | 2019-03-24 13:42 | 191K | |
![[IMG]](/icons/image2.gif) | Oath of Druids (1).jpg | 2019-03-24 13:42 | 202K | |
![[IMG]](/icons/image2.gif) | Necroplasm (1).jpg | 2019-03-24 13:42 | 204K | |
![[IMG]](/icons/image2.gif) | Grab the Reins (1).jpg | 2019-03-24 13:42 | 206K | |
![[IMG]](/icons/image2.gif) | Lavalanche (1).jpg | 2019-03-24 13:42 | 208K | |
![[IMG]](/icons/image2.gif) | Order+Chaos (1).jpg | 2019-03-24 13:42 | 271K | |
![[IMG]](/icons/image2.gif) | Trial+Error (1).jpg | 2019-03-24 13:42 | 273K | |
![[IMG]](/icons/image2.gif) | Soldier+Spirit (1).jpg | 2019-03-24 13:42 | 294K | |
![[IMG]](/icons/image2.gif) | Angel+Cat (1).jpg | 2019-03-24 13:42 | 306K | |
![[IMG]](/icons/image2.gif) | Emblem Ob Nixilis of the Black Oath+Zombie (v2) (1).jpg | 2019-03-24 13:42 | 310K | |
![[IMG]](/icons/image2.gif) | Emblem Teferi, Temporal Archmage+Zombie (v1) (1).jpg | 2019-03-24 13:42 | 316K | |
![[IMG]](/icons/image2.gif) | Kor Soldier+Pegasus (1).jpg | 2019-03-24 13:42 | 323K | |
![[IMG]](/icons/image2.gif) | Myr+Pentavite (1).jpg | 2019-03-24 13:42 | 326K | |
![[IMG]](/icons/image2.gif) | Fish+Zombie (v1) (1).jpg | 2019-03-24 13:42 | 329K | |
![[IMG]](/icons/image2.gif) | Demon (v1)+Zombie (v2) (1).jpg | 2019-03-24 13:42 | 330K | |
![[IMG]](/icons/image2.gif) | Demon (v2)+Zombie (v2) (1).jpg | 2019-03-24 13:42 | 331K | |
![[IMG]](/icons/image2.gif) | Wurm (Lifelink)+Goat (1).jpg | 2019-03-24 13:42 | 335K | |
![[IMG]](/icons/image2.gif) | Wurm (Deathtouch)+Goat (1).jpg | 2019-03-24 13:42 | 343K | |
![[IMG]](/icons/image2.gif) | Ape+Zombie (v1) (1).jpg | 2019-03-24 13:42 | 343K | |
![[IMG]](/icons/image2.gif) | Horror+Zombie (v2) (1).jpg | 2019-03-24 13:42 | 345K | |
![[IMG]](/icons/image2.gif) | Germ+Zombie (v2) (1).jpg | 2019-03-24 13:42 | 346K | |
![[IMG]](/icons/image2.gif) | Stoneforged Blade+Germ (1).jpg | 2019-03-24 13:42 | 347K | |
![[IMG]](/icons/image2.gif) | Emblem Daretti, Scrap Savant+Tuktuk, the Returned (1).jpg | 2019-03-24 13:42 | 357K | |
![[IMG]](/icons/image2.gif) | Kraken+Zombie (v1) (1).jpg | 2019-03-24 13:42 | 358K | |
![[IMG]](/icons/image2.gif) | Elephant+Elf Warrior (1).jpg | 2019-03-24 13:42 | 364K | |
![[IMG]](/icons/image2.gif) | Elemental+Beast (v1) (1).jpg | 2019-03-24 13:42 | 370K | |
![[IMG]](/icons/image2.gif) | Gargoyle+Elf Warrior (1).jpg | 2019-03-24 13:42 | 372K | |
![[IMG]](/icons/image2.gif) | Goblin+Goat (1).jpg | 2019-03-24 13:42 | 379K | |
![[IMG]](/icons/image2.gif) | Beast (v2)+Elf Druid (1).jpg | 2019-03-24 13:42 | 393K | |
![[IMG]](/icons/image2.gif) | Treefolk+Wolf (1).jpg | 2019-03-24 13:42 | 413K | |
|